C15H11ClN6 — CID 22431505
N-(5-chloro-2-methylphenyl)tetrazolo[1,5-a]quinoxalin-4-amine (PubChem CID 22431505) has the molecular formula C15H11ClN6 and a molecular weight of 310.75 g/mol. Its IUPAC name is N-(5-chloro-2-methylphenyl)tetrazolo[1,5-a]quinoxalin-4-amine.
| Compound Name | N-(5-chloro-2-methylphenyl)tetrazolo[1,5-a]quinoxalin-4-amine |
|---|---|
| PubChem CID | 22431505 |
| Molecular Formula | C15H11ClN6 |
| Molecular Weight | 310.75 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | N-(5-chloro-2-methylphenyl)tetrazolo[1,5-a]quinoxalin-4-amine |
| SMILES | Cc1ccc(Cl)cc1Nc1nc2ccccc2n2nnnc12 |
| InChI | InChI=1S/C15H11ClN6/c1-9-6-7-10(16)8-12(9)18-14-15-19-20-21-22(15)13-5-3-2-4-11(13)17-14/h2-8H,1H3,(H,17,18) |
| InChIKey | GVVNKDLZADPFNZ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 68.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.75 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |