C10H9N3O3 — CID 22432121
ethyl 5-pyridin-4-yl-1,3,4-oxadiazole-2-carboxylate (PubChem CID 22432121) has the molecular formula C10H9N3O3 and a molecular weight of 219.20 g/mol. Its IUPAC name is ethyl 5-pyridin-4-yl-1,3,4-oxadiazole-2-carboxylate.
| Compound Name | ethyl 5-pyridin-4-yl-1,3,4-oxadiazole-2-carboxylate |
|---|---|
| PubChem CID | 22432121 |
| Molecular Formula | C10H9N3O3 |
| Molecular Weight | 219.20 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | ethyl 5-pyridin-4-yl-1,3,4-oxadiazole-2-carboxylate |
| SMILES | CCOC(=O)c1nnc(-c2ccncc2)o1 |
| InChI | InChI=1S/C10H9N3O3/c1-2-15-10(14)9-13-12-8(16-9)7-3-5-11-6-4-7/h3-6H,2H2,1H3 |
| InChIKey | FAKFDZBAFPGQEV-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 78.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.20 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |