C23H27NO3S — CID 22436501
S-[1-[3-(2-phenyl-1,3-dioxolan-2-yl)propyl]pyrrolidin-3-yl] benzenecarbothioate (PubChem CID 22436501) has the molecular formula C23H27NO3S and a molecular weight of 397.54 g/mol. Its IUPAC name is S-[1-[3-(2-phenyl-1,3-dioxolan-2-yl)propyl]pyrrolidin-3-yl] benzenecarbothioate.
| Compound Name | S-[1-[3-(2-phenyl-1,3-dioxolan-2-yl)propyl]pyrrolidin-3-yl] benzenecarbothioate |
|---|---|
| PubChem CID | 22436501 |
| Molecular Formula | C23H27NO3S |
| Molecular Weight | 397.54 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | S-[1-[3-(2-phenyl-1,3-dioxolan-2-yl)propyl]pyrrolidin-3-yl] benzenecarbothioate |
| SMILES | O=C(SC1CCN(CCCC2(c3ccccc3)OCCO2)C1)c1ccccc1 |
| InChI | InChI=1S/C23H27NO3S/c25-22(19-8-3-1-4-9-19)28-21-12-15-24(18-21)14-7-13-23(26-16-17-27-23)20-10-5-2-6-11-20/h1-6,8-11,21H,7,12-18H2 |
| InChIKey | WOTRTNIZJPKEKC-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.54 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|