C18H12N2O4S2 — CID 22439821
3-[1-(benzenesulfonyl)indol-4-yl]-4-methylidene-1,3-thiazolidine-2,5-dione (PubChem CID 22439821) has the molecular formula C18H12N2O4S2 and a molecular weight of 384.44 g/mol. Its IUPAC name is 3-[1-(benzenesulfonyl)indol-4-yl]-4-methylidene-1,3-thiazolidine-2,5-dione.
| Compound Name | 3-[1-(benzenesulfonyl)indol-4-yl]-4-methylidene-1,3-thiazolidine-2,5-dione |
|---|---|
| PubChem CID | 22439821 |
| Molecular Formula | C18H12N2O4S2 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.02 |
| IUPAC Name | 3-[1-(benzenesulfonyl)indol-4-yl]-4-methylidene-1,3-thiazolidine-2,5-dione |
| SMILES | C=C1C(=O)SC(=O)N1c1cccc2c1ccn2S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H12N2O4S2/c1-12-17(21)25-18(22)20(12)16-9-5-8-15-14(16)10-11-19(15)26(23,24)13-6-3-2-4-7-13/h2-11H,1H2 |
| InChIKey | MRBVPAZTDYKPQZ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 76.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|