About phenyl 2-butylbenzoate
phenyl 2-butylbenzoate (PubChem CID 22439993) has the molecular formula C17H18O2
and a molecular weight of 254.33 g/mol. Its IUPAC name is phenyl 2-butylbenzoate.
Molecular Properties
| Compound Name | phenyl 2-butylbenzoate |
| PubChem CID | 22439993 |
| Molecular Formula | C17H18O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | phenyl 2-butylbenzoate |
| SMILES | CCCCc1ccccc1C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C17H18O2/c1-2-3-9-14-10-7-8-13-16(14)17(18)19-15-11-5-4-6-12-15/h4-8,10-13H,2-3,9H2,1H3 |
| InChIKey | XRYBRXFRTVEUMW-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze phenyl 2-butylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl 2-butylbenzoate?
The IUPAC name of phenyl 2-butylbenzoate (CID 22439993) is phenyl 2-butylbenzoate.
What is the SMILES notation for phenyl 2-butylbenzoate?
The canonical SMILES for phenyl 2-butylbenzoate is CCCCc1ccccc1C(=O)Oc1ccccc1.
What is the InChIKey of phenyl 2-butylbenzoate?
The InChIKey is XRYBRXFRTVEUMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18O2/c1-2-3-9-14-10-7-8-13-16(14)17(18)19-15-11-5-4-6-12-15/h4-8,10-13H,2-3,9H2,1H3.
What are the key properties of phenyl 2-butylbenzoate?
phenyl 2-butylbenzoate has a molecular weight of 254.33 g/mol, XLogP of 4.25, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl 2-butylbenzoate is sourced from PubChem (CID 22439993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).