C20H21N3O2 — CID 22452934
2-amino-3-[4-[(3-ethylisoquinolin-1-yl)amino]phenyl]propanoic acid (PubChem CID 22452934) has the molecular formula C20H21N3O2 and a molecular weight of 335.41 g/mol. Its IUPAC name is 2-amino-3-[4-[(3-ethylisoquinolin-1-yl)amino]phenyl]propanoic acid.
| Compound Name | 2-amino-3-[4-[(3-ethylisoquinolin-1-yl)amino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22452934 |
| Molecular Formula | C20H21N3O2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 2-amino-3-[4-[(3-ethylisoquinolin-1-yl)amino]phenyl]propanoic acid |
| SMILES | CCc1cc2ccccc2c(Nc2ccc(CC(N)C(=O)O)cc2)n1 |
| InChI | InChI=1S/C20H21N3O2/c1-2-15-12-14-5-3-4-6-17(14)19(22-15)23-16-9-7-13(8-10-16)11-18(21)20(24)25/h3-10,12,18H,2,11,21H2,1H3,(H,22,23)(H,24,25) |
| InChIKey | HWFGARDAHSELNM-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |