C21H26N2O5S — CID 22456227
tert-butyl 2-[[3-methyl-4-[(4-methylbenzoyl)amino]phenyl]sulfonylamino]acetate (PubChem CID 22456227) has the molecular formula C21H26N2O5S and a molecular weight of 418.52 g/mol. Its IUPAC name is tert-butyl 2-[[3-methyl-4-[(4-methylbenzoyl)amino]phenyl]sulfonylamino]acetate.
| Compound Name | tert-butyl 2-[[3-methyl-4-[(4-methylbenzoyl)amino]phenyl]sulfonylamino]acetate |
|---|---|
| PubChem CID | 22456227 |
| Molecular Formula | C21H26N2O5S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | tert-butyl 2-[[3-methyl-4-[(4-methylbenzoyl)amino]phenyl]sulfonylamino]acetate |
| SMILES | Cc1ccc(C(=O)Nc2ccc(S(=O)(=O)NCC(=O)OC(C)(C)C)cc2C)cc1 |
| InChI | InChI=1S/C21H26N2O5S/c1-14-6-8-16(9-7-14)20(25)23-18-11-10-17(12-15(18)2)29(26,27)22-13-19(24)28-21(3,4)5/h6-12,22H,13H2,1-5H3,(H,23,25) |
| InChIKey | IIAXDLAHMVZALL-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |