About dimethylamino-ethyl-(propyliminomethylidene)azanium;hydrochloride
dimethylamino-ethyl-(propyliminomethylidene)azanium;hydrochloride (PubChem CID 22457602) has the molecular formula C8H19ClN3+
and a molecular weight of 192.71 g/mol. Its IUPAC name is dimethylamino-ethyl-(propyliminomethylidene)azanium;hydrochloride.
Molecular Properties
| Compound Name | dimethylamino-ethyl-(propyliminomethylidene)azanium;hydrochloride |
| PubChem CID | 22457602 |
| Molecular Formula | C8H19ClN3+ |
| Molecular Weight | 192.71 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | dimethylamino-ethyl-(propyliminomethylidene)azanium;hydrochloride |
| SMILES | CCCN=C=[N+](CC)N(C)C.Cl |
| InChI | InChI=1S/C8H18N3.ClH/c1-5-7-9-8-11(6-2)10(3)4;/h5-7H2,1-4H3;1H/q+1; |
| InChIKey | YEZGBRWTTBLKNV-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 18.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.71 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze dimethylamino-ethyl-(propyliminomethylidene)azanium;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethylamino-ethyl-(propyliminomethylidene)azanium;hydrochloride?
The IUPAC name of dimethylamino-ethyl-(propyliminomethylidene)azanium;hydrochloride (CID 22457602) is dimethylamino-ethyl-(propyliminomethylidene)azanium;hydrochloride.
What is the SMILES notation for dimethylamino-ethyl-(propyliminomethylidene)azanium;hydrochloride?
The canonical SMILES for dimethylamino-ethyl-(propyliminomethylidene)azanium;hydrochloride is CCCN=C=[N+](CC)N(C)C.Cl.
What is the InChIKey of dimethylamino-ethyl-(propyliminomethylidene)azanium;hydrochloride?
The InChIKey is YEZGBRWTTBLKNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N3.ClH/c1-5-7-9-8-11(6-2)10(3)4;/h5-7H2,1-4H3;1H/q+1;.
What are the key properties of dimethylamino-ethyl-(propyliminomethylidene)azanium;hydrochloride?
dimethylamino-ethyl-(propyliminomethylidene)azanium;hydrochloride has a molecular weight of 192.71 g/mol, XLogP of 1.50, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dimethylamino-ethyl-(propyliminomethylidene)azanium;hydrochloride is sourced from PubChem (CID 22457602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).