C19H22N2S — CID 22458206
4-(1-benzylpiperidin-4-yl)-6,7-dihydrothieno[3,2-c]pyridine (PubChem CID 22458206) has the molecular formula C19H22N2S and a molecular weight of 310.47 g/mol. Its IUPAC name is 4-(1-benzylpiperidin-4-yl)-6,7-dihydrothieno[3,2-c]pyridine.
| Compound Name | 4-(1-benzylpiperidin-4-yl)-6,7-dihydrothieno[3,2-c]pyridine |
|---|---|
| PubChem CID | 22458206 |
| Molecular Formula | C19H22N2S |
| Molecular Weight | 310.47 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 4-(1-benzylpiperidin-4-yl)-6,7-dihydrothieno[3,2-c]pyridine |
| SMILES | c1ccc(CN2CCC(C3=NCCc4sccc43)CC2)cc1 |
| InChI | InChI=1S/C19H22N2S/c1-2-4-15(5-3-1)14-21-11-7-16(8-12-21)19-17-9-13-22-18(17)6-10-20-19/h1-5,9,13,16H,6-8,10-12,14H2 |
| InChIKey | JDGUAZVZGYKECR-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.47 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |