C12H11N2O4- — CID 2245909
(E)-4-[2-(3-methylbenzoyl)hydrazinyl]-4-oxobut-2-enoate (PubChem CID 2245909) has the molecular formula C12H11N2O4- and a molecular weight of 247.23 g/mol. Its IUPAC name is (E)-4-[2-(3-methylbenzoyl)hydrazinyl]-4-oxobut-2-enoate.
| Compound Name | (E)-4-[2-(3-methylbenzoyl)hydrazinyl]-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 2245909 |
| Molecular Formula | C12H11N2O4- |
| Molecular Weight | 247.23 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | (E)-4-[2-(3-methylbenzoyl)hydrazinyl]-4-oxobut-2-enoate |
| SMILES | Cc1cccc(C(=O)NNC(=O)/C=C/C(=O)[O-])c1 |
| InChI | InChI=1S/C12H12N2O4/c1-8-3-2-4-9(7-8)12(18)14-13-10(15)5-6-11(16)17/h2-7H,1H3,(H,13,15)(H,14,18)(H,16,17)/p-1/b6-5+ |
| InChIKey | VAHCZPDHUWVIJL-AATRIKPKSA-M |
| XLogP | -0.94 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.23 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|