C8H5F8N3 — CID 2246209
2-methyl-6-(1,1,2,2,2-pentafluoroethyl)-5-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 2246209) has the molecular formula C8H5F8N3 and a molecular weight of 295.13 g/mol. Its IUPAC name is 2-methyl-6-(1,1,2,2,2-pentafluoroethyl)-5-(trifluoromethyl)pyrimidin-4-amine.
| Compound Name | 2-methyl-6-(1,1,2,2,2-pentafluoroethyl)-5-(trifluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 2246209 |
| Molecular Formula | C8H5F8N3 |
| Molecular Weight | 295.13 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | 2-methyl-6-(1,1,2,2,2-pentafluoroethyl)-5-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | Cc1nc(N)c(C(F)(F)F)c(C(F)(F)C(F)(F)F)n1 |
| InChI | InChI=1S/C8H5F8N3/c1-2-18-4(6(9,10)8(14,15)16)3(5(17)19-2)7(11,12)13/h1H3,(H2,17,18,19) |
| InChIKey | FKIPCUVKMZMAFU-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.13 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|