C33H36N2O7S — CID 22462736
oxalic acid;N-[2-[4-[3-[[4-(2-pyrrolidin-1-ylethoxy)phenyl]methyl]-1-benzothiophen-2-yl]phenoxy]ethyl]acetamide (PubChem CID 22462736) has the molecular formula C33H36N2O7S and a molecular weight of 604.72 g/mol. Its IUPAC name is oxalic acid;N-[2-[4-[3-[[4-(2-pyrrolidin-1-ylethoxy)phenyl]methyl]-1-benzothiophen-2-yl]phenoxy]ethyl]acetamide.
| Compound Name | oxalic acid;N-[2-[4-[3-[[4-(2-pyrrolidin-1-ylethoxy)phenyl]methyl]-1-benzothiophen-2-yl]phenoxy]ethyl]acetamide |
|---|---|
| PubChem CID | 22462736 |
| Molecular Formula | C33H36N2O7S |
| Molecular Weight | 604.72 g/mol |
| Exact Mass | 604.22 |
| IUPAC Name | oxalic acid;N-[2-[4-[3-[[4-(2-pyrrolidin-1-ylethoxy)phenyl]methyl]-1-benzothiophen-2-yl]phenoxy]ethyl]acetamide |
| SMILES | CC(=O)NCCOc1ccc(-c2sc3ccccc3c2Cc2ccc(OCCN3CCCC3)cc2)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C31H34N2O3S.C2H2O4/c1-23(34)32-16-20-35-27-14-10-25(11-15-27)31-29(28-6-2-3-7-30(28)37-31)22-24-8-12-26(13-9-24)36-21-19-33-17-4-5-18-33;3-1(4)2(5)6/h2-3,6-15H,4-5,16-22H2,1H3,(H,32,34);(H,3,4)(H,5,6) |
| InChIKey | VSEAEAHEZDHSEO-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.72 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|