C34H38N2O7S — CID 22462760
oxalic acid;N-[1-[4-[3-[[4-(2-pyrrolidin-1-ylethoxy)phenyl]methyl]-1-benzothiophen-2-yl]phenoxy]propan-2-yl]acetamide (PubChem CID 22462760) has the molecular formula C34H38N2O7S and a molecular weight of 618.75 g/mol. Its IUPAC name is oxalic acid;N-[1-[4-[3-[[4-(2-pyrrolidin-1-ylethoxy)phenyl]methyl]-1-benzothiophen-2-yl]phenoxy]propan-2-yl]acetamide.
| Compound Name | oxalic acid;N-[1-[4-[3-[[4-(2-pyrrolidin-1-ylethoxy)phenyl]methyl]-1-benzothiophen-2-yl]phenoxy]propan-2-yl]acetamide |
|---|---|
| PubChem CID | 22462760 |
| Molecular Formula | C34H38N2O7S |
| Molecular Weight | 618.75 g/mol |
| Exact Mass | 618.24 |
| IUPAC Name | oxalic acid;N-[1-[4-[3-[[4-(2-pyrrolidin-1-ylethoxy)phenyl]methyl]-1-benzothiophen-2-yl]phenoxy]propan-2-yl]acetamide |
| SMILES | CC(=O)NC(C)COc1ccc(-c2sc3ccccc3c2Cc2ccc(OCCN3CCCC3)cc2)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C32H36N2O3S.C2H2O4/c1-23(33-24(2)35)22-37-28-15-11-26(12-16-28)32-30(29-7-3-4-8-31(29)38-32)21-25-9-13-27(14-10-25)36-20-19-34-17-5-6-18-34;3-1(4)2(5)6/h3-4,7-16,23H,5-6,17-22H2,1-2H3,(H,33,35);(H,3,4)(H,5,6) |
| InChIKey | HBEJDUYNWYTRAL-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.75 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|