C15H20 — CID 22463170
2-ethyl-4,5,6,7-tetramethyl-1H-indene (PubChem CID 22463170) has the molecular formula C15H20 and a molecular weight of 200.32 g/mol. Its IUPAC name is 2-ethyl-4,5,6,7-tetramethyl-1H-indene.
| Compound Name | 2-ethyl-4,5,6,7-tetramethyl-1H-indene |
|---|---|
| PubChem CID | 22463170 |
| Molecular Formula | C15H20 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | 2-ethyl-4,5,6,7-tetramethyl-1H-indene |
| SMILES | CCC1=Cc2c(C)c(C)c(C)c(C)c2C1 |
| InChI | InChI=1S/C15H20/c1-6-13-7-14-11(4)9(2)10(3)12(5)15(14)8-13/h7H,6,8H2,1-5H3 |
| InChIKey | KIZDOALJYAOJNZ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |