About diazenylmethanesulfinic acid
diazenylmethanesulfinic acid (PubChem CID 22465823) has the molecular formula CH4N2O2S
and a molecular weight of 108.12 g/mol. Its IUPAC name is diazenylmethanesulfinic acid.
Molecular Properties
| Compound Name | diazenylmethanesulfinic acid |
| PubChem CID | 22465823 |
| Molecular Formula | CH4N2O2S |
| Molecular Weight | 108.12 g/mol |
| Exact Mass | 108.00 |
| IUPAC Name | diazenylmethanesulfinic acid |
| SMILES | [H]/N=N/CS(=O)O |
| InChI | InChI=1S/CH4N2O2S/c2-3-1-6(4)5/h2H,1H2,(H,4,5)/b3-2+ |
| InChIKey | ONNFZHAVUSXWTP-NSCUHMNNSA-N |
| XLogP | 0.20 |
| TPSA | 73.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 108.12 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze diazenylmethanesulfinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diazenylmethanesulfinic acid?
The IUPAC name of diazenylmethanesulfinic acid (CID 22465823) is diazenylmethanesulfinic acid.
What is the SMILES notation for diazenylmethanesulfinic acid?
The canonical SMILES for diazenylmethanesulfinic acid is [H]/N=N/CS(=O)O.
What is the InChIKey of diazenylmethanesulfinic acid?
The InChIKey is ONNFZHAVUSXWTP-NSCUHMNNSA-N. The full InChI is InChI=1S/CH4N2O2S/c2-3-1-6(4)5/h2H,1H2,(H,4,5)/b3-2+.
What are the key properties of diazenylmethanesulfinic acid?
diazenylmethanesulfinic acid has a molecular weight of 108.12 g/mol, XLogP of 0.20, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for diazenylmethanesulfinic acid is sourced from PubChem (CID 22465823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).