About 2-diazenylethanethioic S-acid
2-diazenylethanethioic S-acid (PubChem CID 87476873) has the molecular formula C2H4N2OS
and a molecular weight of 104.13 g/mol. Its IUPAC name is 2-diazenylethanethioic S-acid.
Molecular Properties
| Compound Name | 2-diazenylethanethioic S-acid |
| PubChem CID | 87476873 |
| Molecular Formula | C2H4N2OS |
| Molecular Weight | 104.13 g/mol |
| Exact Mass | 104.00 |
| IUPAC Name | 2-diazenylethanethioic S-acid |
| SMILES | [H]/N=N/CC(=O)S |
| InChI | InChI=1S/C2H4N2OS/c3-4-1-2(5)6/h3H,1H2,(H,5,6)/b4-3+ |
| InChIKey | CWCXZCMZVCQJPM-ONEGZZNKSA-N |
| XLogP | 0.47 |
| TPSA | 53.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 104.13 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-diazenylethanethioic S-acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-diazenylethanethioic S-acid?
The IUPAC name of 2-diazenylethanethioic S-acid (CID 87476873) is 2-diazenylethanethioic S-acid.
What is the SMILES notation for 2-diazenylethanethioic S-acid?
The canonical SMILES for 2-diazenylethanethioic S-acid is [H]/N=N/CC(=O)S.
What is the InChIKey of 2-diazenylethanethioic S-acid?
The InChIKey is CWCXZCMZVCQJPM-ONEGZZNKSA-N. The full InChI is InChI=1S/C2H4N2OS/c3-4-1-2(5)6/h3H,1H2,(H,5,6)/b4-3+.
What are the key properties of 2-diazenylethanethioic S-acid?
2-diazenylethanethioic S-acid has a molecular weight of 104.13 g/mol, XLogP of 0.47, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-diazenylethanethioic S-acid is sourced from PubChem (CID 87476873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).