C13H12O4 — CID 22467691
(4,4-dihydroxycyclohexa-2,5-dien-1-yl)-(2-hydroxyphenyl)methanone (PubChem CID 22467691) has the molecular formula C13H12O4 and a molecular weight of 232.23 g/mol. Its IUPAC name is (4,4-dihydroxycyclohexa-2,5-dien-1-yl)-(2-hydroxyphenyl)methanone.
| Compound Name | (4,4-dihydroxycyclohexa-2,5-dien-1-yl)-(2-hydroxyphenyl)methanone |
|---|---|
| PubChem CID | 22467691 |
| Molecular Formula | C13H12O4 |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | (4,4-dihydroxycyclohexa-2,5-dien-1-yl)-(2-hydroxyphenyl)methanone |
| SMILES | O=C(c1ccccc1O)C1C=CC(O)(O)C=C1 |
| InChI | InChI=1S/C13H12O4/c14-11-4-2-1-3-10(11)12(15)9-5-7-13(16,17)8-6-9/h1-9,14,16-17H |
| InChIKey | ZFXASYAAWXZVHG-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|