C19H18BrClN4O2 — CID 22479274
7a-[(4-bromophenyl)methyl]-2-[2-chloro-6-(methylamino)-4-pyridinyl]-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole-1,3-dione (PubChem CID 22479274) has the molecular formula C19H18BrClN4O2 and a molecular weight of 449.74 g/mol. Its IUPAC name is 7a-[(4-bromophenyl)methyl]-2-[2-chloro-6-(methylamino)-4-pyridinyl]-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole-1,3-dione.
| Compound Name | 7a-[(4-bromophenyl)methyl]-2-[2-chloro-6-(methylamino)-4-pyridinyl]-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole-1,3-dione |
|---|---|
| PubChem CID | 22479274 |
| Molecular Formula | C19H18BrClN4O2 |
| Molecular Weight | 449.74 g/mol |
| Exact Mass | 448.03 |
| IUPAC Name | 7a-[(4-bromophenyl)methyl]-2-[2-chloro-6-(methylamino)-4-pyridinyl]-6,7-dihydro-5H-pyrrolo[1,2-c]imidazole-1,3-dione |
| SMILES | CNc1cc(N2C(=O)N3CCCC3(Cc3ccc(Br)cc3)C2=O)cc(Cl)n1 |
| InChI | InChI=1S/C19H18BrClN4O2/c1-22-16-10-14(9-15(21)23-16)25-17(26)19(7-2-8-24(19)18(25)27)11-12-3-5-13(20)6-4-12/h3-6,9-10H,2,7-8,11H2,1H3,(H,22,23) |
| InChIKey | SMDVLRPGRKDTGM-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.74 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|