C10H10ClO5S- — CID 22479344
2-(4-chlorosulfonyl-3,5-dimethylphenoxy)acetate (PubChem CID 22479344) has the molecular formula C10H10ClO5S- and a molecular weight of 277.71 g/mol. Its IUPAC name is 2-(4-chlorosulfonyl-3,5-dimethylphenoxy)acetate.
| Compound Name | 2-(4-chlorosulfonyl-3,5-dimethylphenoxy)acetate |
|---|---|
| PubChem CID | 22479344 |
| Molecular Formula | C10H10ClO5S- |
| Molecular Weight | 277.71 g/mol |
| Exact Mass | 276.99 |
| IUPAC Name | 2-(4-chlorosulfonyl-3,5-dimethylphenoxy)acetate |
| SMILES | Cc1cc(OCC(=O)[O-])cc(C)c1S(=O)(=O)Cl |
| InChI | InChI=1S/C10H11ClO5S/c1-6-3-8(16-5-9(12)13)4-7(2)10(6)17(11,14)15/h3-4H,5H2,1-2H3,(H,12,13)/p-1 |
| InChIKey | KJNSDBCIWPDTGL-UHFFFAOYSA-M |
| XLogP | 0.36 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.71 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |