C18H15ClF3N3O — CID 22481216
N'-[6-[4-chloro-3-(trifluoromethyl)phenoxy]-2,3-dimethylphenyl]-N-cyano-N-methylmethanimidamide (PubChem CID 22481216) has the molecular formula C18H15ClF3N3O and a molecular weight of 381.79 g/mol. Its IUPAC name is N'-[6-[4-chloro-3-(trifluoromethyl)phenoxy]-2,3-dimethylphenyl]-N-cyano-N-methylmethanimidamide.
| Compound Name | N'-[6-[4-chloro-3-(trifluoromethyl)phenoxy]-2,3-dimethylphenyl]-N-cyano-N-methylmethanimidamide |
|---|---|
| PubChem CID | 22481216 |
| Molecular Formula | C18H15ClF3N3O |
| Molecular Weight | 381.79 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | N'-[6-[4-chloro-3-(trifluoromethyl)phenoxy]-2,3-dimethylphenyl]-N-cyano-N-methylmethanimidamide |
| SMILES | Cc1ccc(Oc2ccc(Cl)c(C(F)(F)F)c2)c(/N=C/N(C)C#N)c1C |
| InChI | InChI=1S/C18H15ClF3N3O/c1-11-4-7-16(17(12(11)2)24-10-25(3)9-23)26-13-5-6-15(19)14(8-13)18(20,21)22/h4-8,10H,1-3H3/b24-10+ |
| InChIKey | LDPBJCVFAGOUCQ-YSURURNPSA-N |
| XLogP | 5.84 |
| TPSA | 48.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.79 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|