C21H24ClF3N2O — CID 68586636
N'-[4-(3-tert-butyl-4-chlorophenoxy)-2-methyl-5-(trifluoromethyl)phenyl]-N,N-dimethylmethanimidamide (PubChem CID 68586636) has the molecular formula C21H24ClF3N2O and a molecular weight of 412.88 g/mol. Its IUPAC name is N'-[4-(3-tert-butyl-4-chlorophenoxy)-2-methyl-5-(trifluoromethyl)phenyl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[4-(3-tert-butyl-4-chlorophenoxy)-2-methyl-5-(trifluoromethyl)phenyl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 68586636 |
| Molecular Formula | C21H24ClF3N2O |
| Molecular Weight | 412.88 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | N'-[4-(3-tert-butyl-4-chlorophenoxy)-2-methyl-5-(trifluoromethyl)phenyl]-N,N-dimethylmethanimidamide |
| SMILES | Cc1cc(Oc2ccc(Cl)c(C(C)(C)C)c2)c(C(F)(F)F)cc1/N=C/N(C)C |
| InChI | InChI=1S/C21H24ClF3N2O/c1-13-9-19(16(21(23,24)25)11-18(13)26-12-27(5)6)28-14-7-8-17(22)15(10-14)20(2,3)4/h7-12H,1-6H3/b26-12+ |
| InChIKey | BSCPJQSCTHVUAQ-RPPGKUMJSA-N |
| XLogP | 6.98 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.88 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|