C16H22N2O2 — CID 22486175
1-([1,3]oxazolo[4,5-b]pyridin-2-yl)decan-1-one (PubChem CID 22486175) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is 1-([1,3]oxazolo[4,5-b]pyridin-2-yl)decan-1-one.
| Compound Name | 1-([1,3]oxazolo[4,5-b]pyridin-2-yl)decan-1-one |
|---|---|
| PubChem CID | 22486175 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 1-([1,3]oxazolo[4,5-b]pyridin-2-yl)decan-1-one |
| SMILES | CCCCCCCCCC(=O)c1nc2ncccc2o1 |
| InChI | InChI=1S/C16H22N2O2/c1-2-3-4-5-6-7-8-10-13(19)16-18-15-14(20-16)11-9-12-17-15/h9,11-12H,2-8,10H2,1H3 |
| InChIKey | ZISOEDFMAVZYAD-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|