C12H9N3O — CID 611086
3-([1,3]oxazolo[4,5-b]pyridin-2-yl)aniline (PubChem CID 611086) has the molecular formula C12H9N3O and a molecular weight of 211.22 g/mol. Its IUPAC name is 3-([1,3]oxazolo[4,5-b]pyridin-2-yl)aniline.
| Compound Name | 3-([1,3]oxazolo[4,5-b]pyridin-2-yl)aniline |
|---|---|
| PubChem CID | 611086 |
| Molecular Formula | C12H9N3O |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.07 |
| IUPAC Name | 3-([1,3]oxazolo[4,5-b]pyridin-2-yl)aniline |
| SMILES | Nc1cccc(-c2nc3ncccc3o2)c1 |
| InChI | InChI=1S/C12H9N3O/c13-9-4-1-3-8(7-9)12-15-11-10(16-12)5-2-6-14-11/h1-7H,13H2 |
| InChIKey | HKWQPWPKROMXCJ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|