C32H33NO6S — CID 22486755
azanium;ethoxy sulfate;2,3,4-tris[(E)-2-phenylethenyl]phenol (PubChem CID 22486755) has the molecular formula C32H33NO6S and a molecular weight of 559.68 g/mol. Its IUPAC name is azanium;ethoxy sulfate;2,3,4-tris[(E)-2-phenylethenyl]phenol.
| Compound Name | azanium;ethoxy sulfate;2,3,4-tris[(E)-2-phenylethenyl]phenol |
|---|---|
| PubChem CID | 22486755 |
| Molecular Formula | C32H33NO6S |
| Molecular Weight | 559.68 g/mol |
| Exact Mass | 559.20 |
| IUPAC Name | azanium;ethoxy sulfate;2,3,4-tris[(E)-2-phenylethenyl]phenol |
| SMILES | CCOOS(=O)(=O)[O-].Oc1ccc(/C=C/c2ccccc2)c(/C=C/c2ccccc2)c1/C=C/c1ccccc1.[NH4+] |
| InChI | InChI=1S/C30H24O.C2H6O5S.H3N/c31-30-23-20-27(19-16-24-10-4-1-5-11-24)28(21-17-25-12-6-2-7-13-25)29(30)22-18-26-14-8-3-9-15-26;1-2-6-7-8(3,4)5;/h1-23,31H;2H2,1H3,(H,3,4,5);1H3/b19-16+,21-17+,22-18+;; |
| InChIKey | FVGFDKNVYZONKG-GVLAUMKYSA-N |
| XLogP | 7.69 |
| TPSA | 132.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.68 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|