C34H28O5 — CID 159401430
but-2-enedioic acid;2,3,4-tris(2-phenylethenyl)phenol (PubChem CID 159401430) has the molecular formula C34H28O5 and a molecular weight of 516.59 g/mol. Its IUPAC name is but-2-enedioic acid;2,3,4-tris(2-phenylethenyl)phenol.
| Compound Name | but-2-enedioic acid;2,3,4-tris(2-phenylethenyl)phenol |
|---|---|
| PubChem CID | 159401430 |
| Molecular Formula | C34H28O5 |
| Molecular Weight | 516.59 g/mol |
| Exact Mass | 516.19 |
| IUPAC Name | but-2-enedioic acid;2,3,4-tris(2-phenylethenyl)phenol |
| SMILES | O=C(O)C=CC(=O)O.Oc1ccc(C=Cc2ccccc2)c(C=Cc2ccccc2)c1C=Cc1ccccc1 |
| InChI | InChI=1S/C30H24O.C4H4O4/c31-30-23-20-27(19-16-24-10-4-1-5-11-24)28(21-17-25-12-6-2-7-13-25)29(30)22-18-26-14-8-3-9-15-26;5-3(6)1-2-4(7)8/h1-23,31H;1-2H,(H,5,6)(H,7,8) |
| InChIKey | LNJRXWVTAGNMBO-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.59 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|