C30H23O4P-2 — CID 18522799
[2,3,4-tris[(E)-2-phenylethenyl]phenyl] phosphate (PubChem CID 18522799) has the molecular formula C30H23O4P-2 and a molecular weight of 478.48 g/mol. Its IUPAC name is [2,3,4-tris[(E)-2-phenylethenyl]phenyl] phosphate.
| Compound Name | [2,3,4-tris[(E)-2-phenylethenyl]phenyl] phosphate |
|---|---|
| PubChem CID | 18522799 |
| Molecular Formula | C30H23O4P-2 |
| Molecular Weight | 478.48 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | [2,3,4-tris[(E)-2-phenylethenyl]phenyl] phosphate |
| SMILES | O=P([O-])([O-])Oc1ccc(/C=C/c2ccccc2)c(/C=C/c2ccccc2)c1/C=C/c1ccccc1 |
| InChI | InChI=1S/C30H25O4P/c31-35(32,33)34-30-23-20-27(19-16-24-10-4-1-5-11-24)28(21-17-25-12-6-2-7-13-25)29(30)22-18-26-14-8-3-9-15-26/h1-23H,(H2,31,32,33)/p-2/b19-16+,21-17+,22-18+ |
| InChIKey | GZNPCWJMNAYNNB-XJVDSWKZSA-L |
| XLogP | 6.41 |
| TPSA | 72.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.48 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|