C25H27N3O6S — CID 2248885
N-[2-[2-[1-(3,4-dimethoxyphenyl)ethenyl]hydrazinyl]-2-oxoethyl]-N-(4-methoxyphenyl)benzenesulfonamide (PubChem CID 2248885) has the molecular formula C25H27N3O6S and a molecular weight of 497.57 g/mol. Its IUPAC name is N-[2-[2-[1-(3,4-dimethoxyphenyl)ethenyl]hydrazinyl]-2-oxoethyl]-N-(4-methoxyphenyl)benzenesulfonamide.
| Compound Name | N-[2-[2-[1-(3,4-dimethoxyphenyl)ethenyl]hydrazinyl]-2-oxoethyl]-N-(4-methoxyphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 2248885 |
| Molecular Formula | C25H27N3O6S |
| Molecular Weight | 497.57 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | N-[2-[2-[1-(3,4-dimethoxyphenyl)ethenyl]hydrazinyl]-2-oxoethyl]-N-(4-methoxyphenyl)benzenesulfonamide |
| SMILES | C=C(NNC(=O)CN(c1ccc(OC)cc1)S(=O)(=O)c1ccccc1)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C25H27N3O6S/c1-18(19-10-15-23(33-3)24(16-19)34-4)26-27-25(29)17-28(20-11-13-21(32-2)14-12-20)35(30,31)22-8-6-5-7-9-22/h5-16,26H,1,17H2,2-4H3,(H,27,29) |
| InChIKey | GSEFYOMCOJPPOV-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.57 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|