C21H22Cl2N2O3 — CID 2249292
2-[[(1R,3S)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropanecarbonyl]amino]ethyl N-naphthalen-1-ylcarbamate (PubChem CID 2249292) has the molecular formula C21H22Cl2N2O3 and a molecular weight of 421.32 g/mol. Its IUPAC name is 2-[[(1R,3S)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropanecarbonyl]amino]ethyl N-naphthalen-1-ylcarbamate.
| Compound Name | 2-[[(1R,3S)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropanecarbonyl]amino]ethyl N-naphthalen-1-ylcarbamate |
|---|---|
| PubChem CID | 2249292 |
| Molecular Formula | C21H22Cl2N2O3 |
| Molecular Weight | 421.32 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | 2-[[(1R,3S)-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropanecarbonyl]amino]ethyl N-naphthalen-1-ylcarbamate |
| SMILES | CC1(C)[C@H](C=C(Cl)Cl)[C@H]1C(=O)NCCOC(=O)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C21H22Cl2N2O3/c1-21(2)15(12-17(22)23)18(21)19(26)24-10-11-28-20(27)25-16-9-5-7-13-6-3-4-8-14(13)16/h3-9,12,15,18H,10-11H2,1-2H3,(H,24,26)(H,25,27)/t15-,18+/m1/s1 |
| InChIKey | NZXQJRPQUCYLGF-QAPCUYQASA-N |
| XLogP | 5.10 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.32 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|