C19H24Cl2N2O3 — CID 3115347
2-[[3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropanecarbonyl]amino]ethyl N-(2,5-dimethylphenyl)carbamate (PubChem CID 3115347) has the molecular formula C19H24Cl2N2O3 and a molecular weight of 399.32 g/mol. Its IUPAC name is 2-[[3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropanecarbonyl]amino]ethyl N-(2,5-dimethylphenyl)carbamate.
| Compound Name | 2-[[3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropanecarbonyl]amino]ethyl N-(2,5-dimethylphenyl)carbamate |
|---|---|
| PubChem CID | 3115347 |
| Molecular Formula | C19H24Cl2N2O3 |
| Molecular Weight | 399.32 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | 2-[[3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropanecarbonyl]amino]ethyl N-(2,5-dimethylphenyl)carbamate |
| SMILES | Cc1ccc(C)c(NC(=O)OCCNC(=O)C2C(C=C(Cl)Cl)C2(C)C)c1 |
| InChI | InChI=1S/C19H24Cl2N2O3/c1-11-5-6-12(2)14(9-11)23-18(25)26-8-7-22-17(24)16-13(10-15(20)21)19(16,3)4/h5-6,9-10,13,16H,7-8H2,1-4H3,(H,22,24)(H,23,25) |
| InChIKey | CNAINYWIMFQXLD-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.32 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|