C14H15Cl3N2O — CID 11393458
N-[(2-chloro-4-pyridinyl)methyl]-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxamide (PubChem CID 11393458) has the molecular formula C14H15Cl3N2O and a molecular weight of 333.65 g/mol. Its IUPAC name is N-[(2-chloro-4-pyridinyl)methyl]-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxamide.
| Compound Name | N-[(2-chloro-4-pyridinyl)methyl]-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 11393458 |
| Molecular Formula | C14H15Cl3N2O |
| Molecular Weight | 333.65 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | N-[(2-chloro-4-pyridinyl)methyl]-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropane-1-carboxamide |
| SMILES | CC1(C)C(C=C(Cl)Cl)C1C(=O)NCc1ccnc(Cl)c1 |
| InChI | InChI=1S/C14H15Cl3N2O/c1-14(2)9(6-10(15)16)12(14)13(20)19-7-8-3-4-18-11(17)5-8/h3-6,9,12H,7H2,1-2H3,(H,19,20) |
| InChIKey | QNJRCXAGFZTOQO-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.65 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|