C12H17NO — CID 22493595
5,8-dimethyl-1,2,5,6,7,8-hexahydroquinoline-2-carbaldehyde (PubChem CID 22493595) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is 5,8-dimethyl-1,2,5,6,7,8-hexahydroquinoline-2-carbaldehyde.
| Compound Name | 5,8-dimethyl-1,2,5,6,7,8-hexahydroquinoline-2-carbaldehyde |
|---|---|
| PubChem CID | 22493595 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 5,8-dimethyl-1,2,5,6,7,8-hexahydroquinoline-2-carbaldehyde |
| SMILES | CC1CCC(C)C2=C1C=CC(C=O)N2 |
| InChI | InChI=1S/C12H17NO/c1-8-3-4-9(2)12-11(8)6-5-10(7-14)13-12/h5-10,13H,3-4H2,1-2H3 |
| InChIKey | DMKBYDWCAIELLM-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|