C14H15ClN4O3 — CID 22495803
5-chloro-2-(1,4-diazabicyclo[3.2.2]nonan-4-yl)-6-nitro-1,3-benzoxazole (PubChem CID 22495803) has the molecular formula C14H15ClN4O3 and a molecular weight of 322.75 g/mol. Its IUPAC name is 5-chloro-2-(1,4-diazabicyclo[3.2.2]nonan-4-yl)-6-nitro-1,3-benzoxazole.
| Compound Name | 5-chloro-2-(1,4-diazabicyclo[3.2.2]nonan-4-yl)-6-nitro-1,3-benzoxazole |
|---|---|
| PubChem CID | 22495803 |
| Molecular Formula | C14H15ClN4O3 |
| Molecular Weight | 322.75 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 5-chloro-2-(1,4-diazabicyclo[3.2.2]nonan-4-yl)-6-nitro-1,3-benzoxazole |
| SMILES | O=[N+]([O-])c1cc2oc(N3CCN4CCC3CC4)nc2cc1Cl |
| InChI | InChI=1S/C14H15ClN4O3/c15-10-7-11-13(8-12(10)19(20)21)22-14(16-11)18-6-5-17-3-1-9(18)2-4-17/h7-9H,1-6H2 |
| InChIKey | WKVCPTIXTLOXRV-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 75.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.75 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|