C8H5ClN2O3S — CID 22495791
6-chloro-2-methylsulfanyl-5-nitro-1,3-benzoxazole (PubChem CID 22495791) has the molecular formula C8H5ClN2O3S and a molecular weight of 244.66 g/mol. Its IUPAC name is 6-chloro-2-methylsulfanyl-5-nitro-1,3-benzoxazole.
| Compound Name | 6-chloro-2-methylsulfanyl-5-nitro-1,3-benzoxazole |
|---|---|
| PubChem CID | 22495791 |
| Molecular Formula | C8H5ClN2O3S |
| Molecular Weight | 244.66 g/mol |
| Exact Mass | 243.97 |
| IUPAC Name | 6-chloro-2-methylsulfanyl-5-nitro-1,3-benzoxazole |
| SMILES | CSc1nc2cc([N+](=O)[O-])c(Cl)cc2o1 |
| InChI | InChI=1S/C8H5ClN2O3S/c1-15-8-10-5-3-6(11(12)13)4(9)2-7(5)14-8/h2-3H,1H3 |
| InChIKey | QOWGJZZVUURPBG-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 69.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.66 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|