C12H2ClN5O2S2 — CID 19770829
2-(6-chloro-7-nitro-[1,3]dithiolo[4,5-b]quinoxalin-2-ylidene)propanedinitrile (PubChem CID 19770829) has the molecular formula C12H2ClN5O2S2 and a molecular weight of 347.77 g/mol. Its IUPAC name is 2-(6-chloro-7-nitro-[1,3]dithiolo[4,5-b]quinoxalin-2-ylidene)propanedinitrile.
| Compound Name | 2-(6-chloro-7-nitro-[1,3]dithiolo[4,5-b]quinoxalin-2-ylidene)propanedinitrile |
|---|---|
| PubChem CID | 19770829 |
| Molecular Formula | C12H2ClN5O2S2 |
| Molecular Weight | 347.77 g/mol |
| Exact Mass | 346.93 |
| IUPAC Name | 2-(6-chloro-7-nitro-[1,3]dithiolo[4,5-b]quinoxalin-2-ylidene)propanedinitrile |
| SMILES | N#CC(C#N)=C1Sc2nc3cc(Cl)c([N+](=O)[O-])cc3nc2S1 |
| InChI | InChI=1S/C12H2ClN5O2S2/c13-6-1-7-8(2-9(6)18(19)20)17-11-10(16-7)21-12(22-11)5(3-14)4-15/h1-2H |
| InChIKey | OUFDPQVOIRTUQO-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 116.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.77 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_cyano_D(3)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|