C12H6ClN7O3S — CID 12676699
15-chloro-14-nitro-9-oxo-9lambda4-thia-2,4,6,11,18-pentazatetracyclo[8.8.0.03,8.012,17]octadeca-1(18),3,5,7,10,12,14,16-octaen-7-amine (PubChem CID 12676699) has the molecular formula C12H6ClN7O3S and a molecular weight of 363.75 g/mol. Its IUPAC name is 15-chloro-14-nitro-9-oxo-9lambda4-thia-2,4,6,11,18-pentazatetracyclo[8.8.0.03,8.012,17]octadeca-1(18),3,5,7,10,12,14,16-octaen-7-amine.
| Compound Name | 15-chloro-14-nitro-9-oxo-9lambda4-thia-2,4,6,11,18-pentazatetracyclo[8.8.0.03,8.012,17]octadeca-1(18),3,5,7,10,12,14,16-octaen-7-amine |
|---|---|
| PubChem CID | 12676699 |
| Molecular Formula | C12H6ClN7O3S |
| Molecular Weight | 363.75 g/mol |
| Exact Mass | 362.99 |
| IUPAC Name | 15-chloro-14-nitro-9-oxo-9lambda4-thia-2,4,6,11,18-pentazatetracyclo[8.8.0.03,8.012,17]octadeca-1(18),3,5,7,10,12,14,16-octaen-7-amine |
| SMILES | Nc1ncnc2c1S(=O)c1nc3cc([N+](=O)[O-])c(Cl)cc3nc1N2 |
| InChI | InChI=1S/C12H6ClN7O3S/c13-4-1-5-6(2-7(4)20(21)22)18-12-11(17-5)19-10-8(24(12)23)9(14)15-3-16-10/h1-3H,(H3,14,15,16,17,19) |
| InChIKey | OFCSWXSVTLAHOV-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 149.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.75 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|