C20H27N5O — CID 22496166
2-[(4,6-dipyrrolidin-1-ylpyrimidin-2-yl)amino]-1-phenylethanol (PubChem CID 22496166) has the molecular formula C20H27N5O and a molecular weight of 353.47 g/mol. Its IUPAC name is 2-[(4,6-dipyrrolidin-1-ylpyrimidin-2-yl)amino]-1-phenylethanol.
| Compound Name | 2-[(4,6-dipyrrolidin-1-ylpyrimidin-2-yl)amino]-1-phenylethanol |
|---|---|
| PubChem CID | 22496166 |
| Molecular Formula | C20H27N5O |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.22 |
| IUPAC Name | 2-[(4,6-dipyrrolidin-1-ylpyrimidin-2-yl)amino]-1-phenylethanol |
| SMILES | OC(CNc1nc(N2CCCC2)cc(N2CCCC2)n1)c1ccccc1 |
| InChI | InChI=1S/C20H27N5O/c26-17(16-8-2-1-3-9-16)15-21-20-22-18(24-10-4-5-11-24)14-19(23-20)25-12-6-7-13-25/h1-3,8-9,14,17,26H,4-7,10-13,15H2,(H,21,22,23) |
| InChIKey | JJKBRFOGYBMIAE-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 64.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |