C23H21NO4S — CID 22496328
3-[[2-(4-methoxyphenyl)acetyl]-prop-2-enylamino]-4-phenylthiophene-2-carboxylic acid (PubChem CID 22496328) has the molecular formula C23H21NO4S and a molecular weight of 407.49 g/mol. Its IUPAC name is 3-[[2-(4-methoxyphenyl)acetyl]-prop-2-enylamino]-4-phenylthiophene-2-carboxylic acid.
| Compound Name | 3-[[2-(4-methoxyphenyl)acetyl]-prop-2-enylamino]-4-phenylthiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 22496328 |
| Molecular Formula | C23H21NO4S |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | 3-[[2-(4-methoxyphenyl)acetyl]-prop-2-enylamino]-4-phenylthiophene-2-carboxylic acid |
| SMILES | C=CCN(C(=O)Cc1ccc(OC)cc1)c1c(-c2ccccc2)csc1C(=O)O |
| InChI | InChI=1S/C23H21NO4S/c1-3-13-24(20(25)14-16-9-11-18(28-2)12-10-16)21-19(15-29-22(21)23(26)27)17-7-5-4-6-8-17/h3-12,15H,1,13-14H2,2H3,(H,26,27) |
| InChIKey | QUAMXOWMQLPWJT-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|