C14H13NO7S — CID 22498045
2-[2-(nitromethylsulfonyl)benzoyl]cyclohexane-1,3-dione (PubChem CID 22498045) has the molecular formula C14H13NO7S and a molecular weight of 339.33 g/mol. Its IUPAC name is 2-[2-(nitromethylsulfonyl)benzoyl]cyclohexane-1,3-dione.
| Compound Name | 2-[2-(nitromethylsulfonyl)benzoyl]cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 22498045 |
| Molecular Formula | C14H13NO7S |
| Molecular Weight | 339.33 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | 2-[2-(nitromethylsulfonyl)benzoyl]cyclohexane-1,3-dione |
| SMILES | O=C1CCCC(=O)C1C(=O)c1ccccc1S(=O)(=O)C[N+](=O)[O-] |
| InChI | InChI=1S/C14H13NO7S/c16-10-5-3-6-11(17)13(10)14(18)9-4-1-2-7-12(9)23(21,22)8-15(19)20/h1-2,4,7,13H,3,5-6,8H2 |
| InChIKey | FLUQKKYXPZWLBZ-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 128.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.33 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|