C22H22ClNO5S — CID 22498233
1-[2-[2-chloro-5-hydroxy-4-(2-methoxyphenyl)sulfanylphenyl]prop-2-enoyl]piperidine-3-carboxylic acid (PubChem CID 22498233) has the molecular formula C22H22ClNO5S and a molecular weight of 447.94 g/mol. Its IUPAC name is 1-[2-[2-chloro-5-hydroxy-4-(2-methoxyphenyl)sulfanylphenyl]prop-2-enoyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[2-[2-chloro-5-hydroxy-4-(2-methoxyphenyl)sulfanylphenyl]prop-2-enoyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 22498233 |
| Molecular Formula | C22H22ClNO5S |
| Molecular Weight | 447.94 g/mol |
| Exact Mass | 447.09 |
| IUPAC Name | 1-[2-[2-chloro-5-hydroxy-4-(2-methoxyphenyl)sulfanylphenyl]prop-2-enoyl]piperidine-3-carboxylic acid |
| SMILES | C=C(C(=O)N1CCCC(C(=O)O)C1)c1cc(O)c(Sc2ccccc2OC)cc1Cl |
| InChI | InChI=1S/C22H22ClNO5S/c1-13(21(26)24-9-5-6-14(12-24)22(27)28)15-10-17(25)20(11-16(15)23)30-19-8-4-3-7-18(19)29-2/h3-4,7-8,10-11,14,25H,1,5-6,9,12H2,2H3,(H,27,28) |
| InChIKey | ZTDJTYLTYPFTQV-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.94 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|