C24H25F3N2O2S — CID 22498491
2-[4-(2-methylphenyl)sulfanyl-3-(trifluoromethyl)phenyl]-N-[3-(2-oxopyrrolidin-1-yl)propyl]prop-2-enamide (PubChem CID 22498491) has the molecular formula C24H25F3N2O2S and a molecular weight of 462.54 g/mol. Its IUPAC name is 2-[4-(2-methylphenyl)sulfanyl-3-(trifluoromethyl)phenyl]-N-[3-(2-oxopyrrolidin-1-yl)propyl]prop-2-enamide.
| Compound Name | 2-[4-(2-methylphenyl)sulfanyl-3-(trifluoromethyl)phenyl]-N-[3-(2-oxopyrrolidin-1-yl)propyl]prop-2-enamide |
|---|---|
| PubChem CID | 22498491 |
| Molecular Formula | C24H25F3N2O2S |
| Molecular Weight | 462.54 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | 2-[4-(2-methylphenyl)sulfanyl-3-(trifluoromethyl)phenyl]-N-[3-(2-oxopyrrolidin-1-yl)propyl]prop-2-enamide |
| SMILES | C=C(C(=O)NCCCN1CCCC1=O)c1ccc(Sc2ccccc2C)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H25F3N2O2S/c1-16-7-3-4-8-20(16)32-21-11-10-18(15-19(21)24(25,26)27)17(2)23(31)28-12-6-14-29-13-5-9-22(29)30/h3-4,7-8,10-11,15H,2,5-6,9,12-14H2,1H3,(H,28,31) |
| InChIKey | GTKQOCBWINTEEK-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.54 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|