C15H9BrCl2O2S — CID 22498576
2-[4-(3-bromophenyl)sulfanyl-2,3-dichlorophenyl]prop-2-enoic acid (PubChem CID 22498576) has the molecular formula C15H9BrCl2O2S and a molecular weight of 404.11 g/mol. Its IUPAC name is 2-[4-(3-bromophenyl)sulfanyl-2,3-dichlorophenyl]prop-2-enoic acid.
| Compound Name | 2-[4-(3-bromophenyl)sulfanyl-2,3-dichlorophenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 22498576 |
| Molecular Formula | C15H9BrCl2O2S |
| Molecular Weight | 404.11 g/mol |
| Exact Mass | 401.89 |
| IUPAC Name | 2-[4-(3-bromophenyl)sulfanyl-2,3-dichlorophenyl]prop-2-enoic acid |
| SMILES | C=C(C(=O)O)c1ccc(Sc2cccc(Br)c2)c(Cl)c1Cl |
| InChI | InChI=1S/C15H9BrCl2O2S/c1-8(15(19)20)11-5-6-12(14(18)13(11)17)21-10-4-2-3-9(16)7-10/h2-7H,1H2,(H,19,20) |
| InChIKey | COASCXVKLCTXBQ-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.11 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|