C16H17F3N4O3S — CID 22499661
5-(cyclopentylamino)-1-(6-methylsulfonyl-3-pyridinyl)-3-(trifluoromethyl)pyrazole-4-carbaldehyde (PubChem CID 22499661) has the molecular formula C16H17F3N4O3S and a molecular weight of 402.40 g/mol. Its IUPAC name is 5-(cyclopentylamino)-1-(6-methylsulfonyl-3-pyridinyl)-3-(trifluoromethyl)pyrazole-4-carbaldehyde.
| Compound Name | 5-(cyclopentylamino)-1-(6-methylsulfonyl-3-pyridinyl)-3-(trifluoromethyl)pyrazole-4-carbaldehyde |
|---|---|
| PubChem CID | 22499661 |
| Molecular Formula | C16H17F3N4O3S |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | 5-(cyclopentylamino)-1-(6-methylsulfonyl-3-pyridinyl)-3-(trifluoromethyl)pyrazole-4-carbaldehyde |
| SMILES | CS(=O)(=O)c1ccc(-n2nc(C(F)(F)F)c(C=O)c2NC2CCCC2)cn1 |
| InChI | InChI=1S/C16H17F3N4O3S/c1-27(25,26)13-7-6-11(8-20-13)23-15(21-10-4-2-3-5-10)12(9-24)14(22-23)16(17,18)19/h6-10,21H,2-5H2,1H3 |
| InChIKey | VBYISQBPBGHXCY-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 93.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|