C35H40N4O4 — CID 22501837
3-[[4-[(4-tert-butylcyclohexyl)-[[4-(4-cyanophenyl)phenyl]carbamoylamino]methyl]benzoyl]amino]propanoic acid (PubChem CID 22501837) has the molecular formula C35H40N4O4 and a molecular weight of 580.73 g/mol. Its IUPAC name is 3-[[4-[(4-tert-butylcyclohexyl)-[[4-(4-cyanophenyl)phenyl]carbamoylamino]methyl]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[(4-tert-butylcyclohexyl)-[[4-(4-cyanophenyl)phenyl]carbamoylamino]methyl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 22501837 |
| Molecular Formula | C35H40N4O4 |
| Molecular Weight | 580.73 g/mol |
| Exact Mass | 580.30 |
| IUPAC Name | 3-[[4-[(4-tert-butylcyclohexyl)-[[4-(4-cyanophenyl)phenyl]carbamoylamino]methyl]benzoyl]amino]propanoic acid |
| SMILES | CC(C)(C)C1CCC(C(NC(=O)Nc2ccc(-c3ccc(C#N)cc3)cc2)c2ccc(C(=O)NCCC(=O)O)cc2)CC1 |
| InChI | InChI=1S/C35H40N4O4/c1-35(2,3)29-16-12-27(13-17-29)32(26-8-10-28(11-9-26)33(42)37-21-20-31(40)41)39-34(43)38-30-18-14-25(15-19-30)24-6-4-23(22-36)5-7-24/h4-11,14-15,18-19,27,29,32H,12-13,16-17,20-21H2,1-3H3,(H,37,42)(H,40,41)(H2,38,39,43) |
| InChIKey | NGBAATWYCKKTGC-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 131.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.73 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |