C18H15N3O4 — CID 91349117
4-[4-[(4-cyanobenzoyl)amino]phenyl]-4-nitrosobutanoic acid (PubChem CID 91349117) has the molecular formula C18H15N3O4 and a molecular weight of 337.34 g/mol. Its IUPAC name is 4-[4-[(4-cyanobenzoyl)amino]phenyl]-4-nitrosobutanoic acid.
| Compound Name | 4-[4-[(4-cyanobenzoyl)amino]phenyl]-4-nitrosobutanoic acid |
|---|---|
| PubChem CID | 91349117 |
| Molecular Formula | C18H15N3O4 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | 4-[4-[(4-cyanobenzoyl)amino]phenyl]-4-nitrosobutanoic acid |
| SMILES | N#Cc1ccc(C(=O)Nc2ccc(C(CCC(=O)O)N=O)cc2)cc1 |
| InChI | InChI=1S/C18H15N3O4/c19-11-12-1-3-14(4-2-12)18(24)20-15-7-5-13(6-8-15)16(21-25)9-10-17(22)23/h1-8,16H,9-10H2,(H,20,24)(H,22,23) |
| InChIKey | DHNOSDXNTPQYIB-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 119.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |