C15H15N3O6 — CID 22503929
1-[2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]-3-(4-nitrophenyl)urea (PubChem CID 22503929) has the molecular formula C15H15N3O6 and a molecular weight of 333.30 g/mol. Its IUPAC name is 1-[2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]-3-(4-nitrophenyl)urea.
| Compound Name | 1-[2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]-3-(4-nitrophenyl)urea |
|---|---|
| PubChem CID | 22503929 |
| Molecular Formula | C15H15N3O6 |
| Molecular Weight | 333.30 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | 1-[2-(3,4-dihydroxyphenyl)-2-hydroxyethyl]-3-(4-nitrophenyl)urea |
| SMILES | O=C(NCC(O)c1ccc(O)c(O)c1)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H15N3O6/c19-12-6-1-9(7-13(12)20)14(21)8-16-15(22)17-10-2-4-11(5-3-10)18(23)24/h1-7,14,19-21H,8H2,(H2,16,17,22) |
| InChIKey | WJBZFXRJDFVHCA-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 144.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.30 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|