C22H17N2O3S- — CID 22506510
2,3-dianilinonaphthalene-1-sulfonate (PubChem CID 22506510) has the molecular formula C22H17N2O3S- and a molecular weight of 389.46 g/mol. Its IUPAC name is 2,3-dianilinonaphthalene-1-sulfonate.
| Compound Name | 2,3-dianilinonaphthalene-1-sulfonate |
|---|---|
| PubChem CID | 22506510 |
| Molecular Formula | C22H17N2O3S- |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | 2,3-dianilinonaphthalene-1-sulfonate |
| SMILES | O=S(=O)([O-])c1c(Nc2ccccc2)c(Nc2ccccc2)cc2ccccc12 |
| InChI | InChI=1S/C22H18N2O3S/c25-28(26,27)22-19-14-8-7-9-16(19)15-20(23-17-10-3-1-4-11-17)21(22)24-18-12-5-2-6-13-18/h1-15,23-24H,(H,25,26,27)/p-1 |
| InChIKey | MMWZCHYQYDARPF-UHFFFAOYSA-M |
| XLogP | 5.23 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|