C8H8F3NO2 — CID 22507269
5-(3,3,3-trifluoropropyl)-1H-pyrrole-2-carboxylic acid (PubChem CID 22507269) has the molecular formula C8H8F3NO2 and a molecular weight of 207.15 g/mol. Its IUPAC name is 5-(3,3,3-trifluoropropyl)-1H-pyrrole-2-carboxylic acid.
| Compound Name | 5-(3,3,3-trifluoropropyl)-1H-pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 22507269 |
| Molecular Formula | C8H8F3NO2 |
| Molecular Weight | 207.15 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | 5-(3,3,3-trifluoropropyl)-1H-pyrrole-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(CCC(F)(F)F)[nH]1 |
| InChI | InChI=1S/C8H8F3NO2/c9-8(10,11)4-3-5-1-2-6(12-5)7(13)14/h1-2,12H,3-4H2,(H,13,14) |
| InChIKey | BQGKGKHCQPBLAP-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.15 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |