C24H24N4OS — CID 22511709
N-benzyl-3-[(1-phenyl-5-pyrrol-1-ylpyrazol-4-yl)methylsulfanyl]propanamide (PubChem CID 22511709) has the molecular formula C24H24N4OS and a molecular weight of 416.55 g/mol. Its IUPAC name is N-benzyl-3-[(1-phenyl-5-pyrrol-1-ylpyrazol-4-yl)methylsulfanyl]propanamide.
| Compound Name | N-benzyl-3-[(1-phenyl-5-pyrrol-1-ylpyrazol-4-yl)methylsulfanyl]propanamide |
|---|---|
| PubChem CID | 22511709 |
| Molecular Formula | C24H24N4OS |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | N-benzyl-3-[(1-phenyl-5-pyrrol-1-ylpyrazol-4-yl)methylsulfanyl]propanamide |
| SMILES | O=C(CCSCc1cnn(-c2ccccc2)c1-n1cccc1)NCc1ccccc1 |
| InChI | InChI=1S/C24H24N4OS/c29-23(25-17-20-9-3-1-4-10-20)13-16-30-19-21-18-26-28(22-11-5-2-6-12-22)24(21)27-14-7-8-15-27/h1-12,14-15,18H,13,16-17,19H2,(H,25,29) |
| InChIKey | CPRPFCXLZZMGNX-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 51.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|