C23H28N4OS — CID 3563935
N-cycloheptyl-2-[(1-phenyl-5-pyrrol-1-ylpyrazol-4-yl)methylsulfanyl]acetamide (PubChem CID 3563935) has the molecular formula C23H28N4OS and a molecular weight of 408.57 g/mol. Its IUPAC name is N-cycloheptyl-2-[(1-phenyl-5-pyrrol-1-ylpyrazol-4-yl)methylsulfanyl]acetamide.
| Compound Name | N-cycloheptyl-2-[(1-phenyl-5-pyrrol-1-ylpyrazol-4-yl)methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 3563935 |
| Molecular Formula | C23H28N4OS |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | N-cycloheptyl-2-[(1-phenyl-5-pyrrol-1-ylpyrazol-4-yl)methylsulfanyl]acetamide |
| SMILES | O=C(CSCc1cnn(-c2ccccc2)c1-n1cccc1)NC1CCCCCC1 |
| InChI | InChI=1S/C23H28N4OS/c28-22(25-20-10-4-1-2-5-11-20)18-29-17-19-16-24-27(21-12-6-3-7-13-21)23(19)26-14-8-9-15-26/h3,6-9,12-16,20H,1-2,4-5,10-11,17-18H2,(H,25,28) |
| InChIKey | BUQCVSCIHNIESR-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 51.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |