C21H24N4OS — CID 4259938
2-[(1-phenyl-5-pyrrol-1-ylpyrazol-4-yl)methylsulfanyl]-1-piperidin-1-ylethanone (PubChem CID 4259938) has the molecular formula C21H24N4OS and a molecular weight of 380.52 g/mol. Its IUPAC name is 2-[(1-phenyl-5-pyrrol-1-ylpyrazol-4-yl)methylsulfanyl]-1-piperidin-1-ylethanone.
| Compound Name | 2-[(1-phenyl-5-pyrrol-1-ylpyrazol-4-yl)methylsulfanyl]-1-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 4259938 |
| Molecular Formula | C21H24N4OS |
| Molecular Weight | 380.52 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 2-[(1-phenyl-5-pyrrol-1-ylpyrazol-4-yl)methylsulfanyl]-1-piperidin-1-ylethanone |
| SMILES | O=C(CSCc1cnn(-c2ccccc2)c1-n1cccc1)N1CCCCC1 |
| InChI | InChI=1S/C21H24N4OS/c26-20(23-11-5-2-6-12-23)17-27-16-18-15-22-25(19-9-3-1-4-10-19)21(18)24-13-7-8-14-24/h1,3-4,7-10,13-15H,2,5-6,11-12,16-17H2 |
| InChIKey | PCYPUWMBFMGVPC-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 43.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.52 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |